C26H36O4 — CID 70289562
4-(2-methylprop-2-enoyloxy)-2-[[4-(4-pentylcyclohexyl)phenyl]methylidene]butanoic acid (PubChem CID 70289562) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-pentylcyclohexyl)phenyl]methylidene]butanoic acid.
| Compound Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-pentylcyclohexyl)phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70289562 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-pentylcyclohexyl)phenyl]methylidene]butanoic acid |
| SMILES | C=C(C)C(=O)OCCC(=Cc1ccc(C2CCC(CCCCC)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C26H36O4/c1-4-5-6-7-20-8-12-22(13-9-20)23-14-10-21(11-15-23)18-24(25(27)28)16-17-30-26(29)19(2)3/h10-11,14-15,18,20,22H,2,4-9,12-13,16-17H2,1,3H3,(H,27,28) |
| InChIKey | CFFICQOLPDQJAH-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|