C24H42O3Si2 — CID 173292973
pentyl (E)-2-methyl-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoate;silyloxysilane (PubChem CID 173292973) has the molecular formula C24H42O3Si2 and a molecular weight of 434.77 g/mol. Its IUPAC name is pentyl (E)-2-methyl-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoate;silyloxysilane.
| Compound Name | pentyl (E)-2-methyl-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoate;silyloxysilane |
|---|---|
| PubChem CID | 173292973 |
| Molecular Formula | C24H42O3Si2 |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | pentyl (E)-2-methyl-3-[4-(4-propylcyclohexyl)phenyl]prop-2-enoate;silyloxysilane |
| SMILES | CCCCCOC(=O)/C(C)=C/c1ccc(C2CCC(CCC)CC2)cc1.[SiH3]O[SiH3] |
| InChI | InChI=1S/C24H36O2.H6OSi2/c1-4-6-7-17-26-24(25)19(3)18-21-11-15-23(16-12-21)22-13-9-20(8-5-2)10-14-22;2-1-3/h11-12,15-16,18,20,22H,4-10,13-14,17H2,1-3H3;2-3H3/b19-18+; |
| InChIKey | YOGQTOGHFKTPOY-LTRPLHCISA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|