C24H32O4 — CID 70289633
4-(2-methylprop-2-enoyloxy)-2-[[4-(4-propylcyclohexyl)phenyl]methylidene]butanoic acid (PubChem CID 70289633) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-propylcyclohexyl)phenyl]methylidene]butanoic acid.
| Compound Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-propylcyclohexyl)phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70289633 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)-2-[[4-(4-propylcyclohexyl)phenyl]methylidene]butanoic acid |
| SMILES | C=C(C)C(=O)OCCC(=Cc1ccc(C2CCC(CCC)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C24H32O4/c1-4-5-18-6-10-20(11-7-18)21-12-8-19(9-13-21)16-22(23(25)26)14-15-28-24(27)17(2)3/h8-9,12-13,16,18,20H,2,4-7,10-11,14-15H2,1,3H3,(H,25,26) |
| InChIKey | JKITXXFJTKVVQU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|