C32H43Cl3O2Si — CID 142687817
(2E)-2-[[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]methylidene]-8-trichlorosilyloctanoic acid (PubChem CID 142687817) has the molecular formula C32H43Cl3O2Si and a molecular weight of 594.14 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]methylidene]-8-trichlorosilyloctanoic acid.
| Compound Name | (2E)-2-[[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]methylidene]-8-trichlorosilyloctanoic acid |
|---|---|
| PubChem CID | 142687817 |
| Molecular Formula | C32H43Cl3O2Si |
| Molecular Weight | 594.14 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | (2E)-2-[[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]methylidene]-8-trichlorosilyloctanoic acid |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(/C=C(\CCCCCC[Si](Cl)(Cl)Cl)C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H43Cl3O2Si/c1-2-3-6-9-25-11-15-27(16-12-25)29-19-21-30(22-20-29)28-17-13-26(14-18-28)24-31(32(36)37)10-7-4-5-8-23-38(33,34)35/h13-14,17-22,24-25,27H,2-12,15-16,23H2,1H3,(H,36,37)/b31-24+ |
| InChIKey | OXOXBYPPUWBSKY-QFMPWRQOSA-N |
| XLogP | 11.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.14 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|