C19H25Cl3O2Si — CID 70126712
(E)-3-[4-[4-(4-trichlorosilylbutyl)cyclohexyl]phenyl]prop-2-enoic acid (PubChem CID 70126712) has the molecular formula C19H25Cl3O2Si and a molecular weight of 419.85 g/mol. Its IUPAC name is (E)-3-[4-[4-(4-trichlorosilylbutyl)cyclohexyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(4-trichlorosilylbutyl)cyclohexyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70126712 |
| Molecular Formula | C19H25Cl3O2Si |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (E)-3-[4-[4-(4-trichlorosilylbutyl)cyclohexyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C2CCC(CCCC[Si](Cl)(Cl)Cl)CC2)cc1 |
| InChI | InChI=1S/C19H25Cl3O2Si/c20-25(21,22)14-2-1-3-15-4-9-17(10-5-15)18-11-6-16(7-12-18)8-13-19(23)24/h6-8,11-13,15,17H,1-5,9-10,14H2,(H,23,24)/b13-8+ |
| InChIKey | GLZWRWSNICDFNX-MDWZMJQESA-N |
| XLogP | 6.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|