C30H42O5Si — CID 67577447
methyl 3-[4-[4-[4-(2-triethoxysilylethyl)cyclohexyl]phenyl]phenyl]prop-2-enoate (PubChem CID 67577447) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is methyl 3-[4-[4-[4-(2-triethoxysilylethyl)cyclohexyl]phenyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[4-[4-(2-triethoxysilylethyl)cyclohexyl]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67577447 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | methyl 3-[4-[4-[4-(2-triethoxysilylethyl)cyclohexyl]phenyl]phenyl]prop-2-enoate |
| SMILES | CCO[Si](CCC1CCC(c2ccc(-c3ccc(C=CC(=O)OC)cc3)cc2)CC1)(OCC)OCC |
| InChI | InChI=1S/C30H42O5Si/c1-5-33-36(34-6-2,35-7-3)23-22-25-10-15-27(16-11-25)29-19-17-28(18-20-29)26-13-8-24(9-14-26)12-21-30(31)32-4/h8-9,12-14,17-21,25,27H,5-7,10-11,15-16,22-23H2,1-4H3 |
| InChIKey | DXKDKFMUISTLHI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|