C23H30N2O2 — CID 174740331
benzene-1,2-diamine;ethyl 3-(4-cyclohexylphenyl)prop-2-enoate (PubChem CID 174740331) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is benzene-1,2-diamine;ethyl 3-(4-cyclohexylphenyl)prop-2-enoate.
| Compound Name | benzene-1,2-diamine;ethyl 3-(4-cyclohexylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 174740331 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | benzene-1,2-diamine;ethyl 3-(4-cyclohexylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(C2CCCCC2)cc1.Nc1ccccc1N |
| InChI | InChI=1S/C17H22O2.C6H8N2/c1-2-19-17(18)13-10-14-8-11-16(12-9-14)15-6-4-3-5-7-15;7-5-3-1-2-4-6(5)8/h8-13,15H,2-7H2,1H3;1-4H,7-8H2 |
| InChIKey | GXBDQEFRJLFRGJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|