About ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate
ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate (PubChem CID 102045523) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate |
| PubChem CID | 102045523 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(N)=N/C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-2-22-17(21)13-10-14-8-11-15(12-9-14)18(19)20-16-6-4-3-5-7-16/h8-13,16H,2-7H2,1H3,(H2,19,20)/b13-10+ |
| InChIKey | GLWWNZPXWGLAAS-JLHYYAGUSA-N |
| XLogP | 3.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate?
The IUPAC name of ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate (CID 102045523) is ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate?
The canonical SMILES for ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate is CCOC(=O)/C=C/c1ccc(/C(N)=N/C2CCCCC2)cc1.
What is the InChIKey of ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate?
The InChIKey is GLWWNZPXWGLAAS-JLHYYAGUSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-2-22-17(21)13-10-14-8-11-15(12-9-14)18(19)20-16-6-4-3-5-7-16/h8-13,16H,2-7H2,1H3,(H2,19,20)/b13-10+.
What are the key properties of ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate?
ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate has a molecular weight of 300.40 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[4-(N'-cyclohexylcarbamimidoyl)phenyl]prop-2-enoate is sourced from PubChem (CID 102045523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).