C24H28O3 — CID 142646014
ethyl 3-[4-(cyclohexylmethoxy)-3-phenylphenyl]prop-2-enoate (PubChem CID 142646014) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 3-[4-(cyclohexylmethoxy)-3-phenylphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-(cyclohexylmethoxy)-3-phenylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142646014 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | ethyl 3-[4-(cyclohexylmethoxy)-3-phenylphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCC2CCCCC2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H28O3/c1-2-26-24(25)16-14-19-13-15-23(27-18-20-9-5-3-6-10-20)22(17-19)21-11-7-4-8-12-21/h4,7-8,11-17,20H,2-3,5-6,9-10,18H2,1H3 |
| InChIKey | JMKPAANZHQDVFR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|