About ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene
ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 174846165) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 174846165 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CC2CCC1O2.CCOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O2.C6H8O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-2-6-4-3-5(1)7-6/h3-9H,2H2,1H3;1-2,5-6H,3-4H2 |
| InChIKey | NCTAMGINROFLAX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene?
The IUPAC name of ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene (CID 174846165) is ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene is C1=CC2CCC1O2.CCOC(=O)C=Cc1ccccc1.
What is the InChIKey of ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene?
The InChIKey is NCTAMGINROFLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C6H8O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-2-6-4-3-5(1)7-6/h3-9H,2H2,1H3;1-2,5-6H,3-4H2.
What are the key properties of ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene?
ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene has a molecular weight of 272.34 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-phenylprop-2-enoate;7-oxabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 174846165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).