C16H18O5 — CID 25172089
(5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl (E)-3-phenylprop-2-enoate (PubChem CID 25172089) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl (E)-3-phenylprop-2-enoate.
| Compound Name | (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 25172089 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl (E)-3-phenylprop-2-enoate |
| SMILES | CCC1(COC(=O)/C=C/c2ccccc2)COC(=O)OC1 |
| InChI | InChI=1S/C16H18O5/c1-2-16(11-20-15(18)21-12-16)10-19-14(17)9-8-13-6-4-3-5-7-13/h3-9H,2,10-12H2,1H3/b9-8+ |
| InChIKey | APSINLVKRINYET-CMDGGOBGSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|