C38H59NO8Si — CID 67672608
6-(2-triethoxysilylethylcarbamoyloxy)hexyl (E)-3-[6-[(4-propylcyclohexyl)methoxy]naphthalen-2-yl]prop-2-enoate (PubChem CID 67672608) has the molecular formula C38H59NO8Si and a molecular weight of 685.97 g/mol. Its IUPAC name is 6-(2-triethoxysilylethylcarbamoyloxy)hexyl (E)-3-[6-[(4-propylcyclohexyl)methoxy]naphthalen-2-yl]prop-2-enoate.
| Compound Name | 6-(2-triethoxysilylethylcarbamoyloxy)hexyl (E)-3-[6-[(4-propylcyclohexyl)methoxy]naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67672608 |
| Molecular Formula | C38H59NO8Si |
| Molecular Weight | 685.97 g/mol |
| Exact Mass | 685.40 |
| IUPAC Name | 6-(2-triethoxysilylethylcarbamoyloxy)hexyl (E)-3-[6-[(4-propylcyclohexyl)methoxy]naphthalen-2-yl]prop-2-enoate |
| SMILES | CCCC1CCC(COc2ccc3cc(/C=C/C(=O)OCCCCCCOC(=O)NCC[Si](OCC)(OCC)OCC)ccc3c2)CC1 |
| InChI | InChI=1S/C38H59NO8Si/c1-5-13-31-14-16-33(17-15-31)30-44-36-22-21-34-28-32(18-20-35(34)29-36)19-23-37(40)42-25-11-9-10-12-26-43-38(41)39-24-27-48(45-6-2,46-7-3)47-8-4/h18-23,28-29,31,33H,5-17,24-27,30H2,1-4H3,(H,39,41)/b23-19+ |
| InChIKey | BNTYFEKNVCATCV-FCDQGJHFSA-N |
| XLogP | 8.72 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.97 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|