C19H26O3 — CID 6048720
(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 6048720) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6048720 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H26O3/c1-3-4-15-7-12-18(13-8-15)22-19(20)14-9-16-5-10-17(21-2)11-6-16/h5-6,9-11,14-15,18H,3-4,7-8,12-13H2,1-2H3/b14-9+ |
| InChIKey | RRVWESUXPGQASF-NTEUORMPSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|