(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate

C19H26O3 — CID 6048720

IUPAC(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate
SMILESCCCC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)CC1
InChIInChI=1S/C19H26O3/c1-3-4-15-7-12-18(13-8-15)22-19(20)14-9-16-5-10-17(21-2)11-6-16/h5-6,9-11,14-15,18H,3-4,7-8,12-13H2,1-2H3/b14-9+
InChIKeyRRVWESUXPGQASF-NTEUORMPSA-N
MW302.41 g/mol
LogP4.61
Rot. Bonds6

About (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate

(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 6048720) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate.

Molecular Properties

Compound Name(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate
PubChem CID6048720
Molecular FormulaC19H26O3
Molecular Weight302.41 g/mol
Exact Mass302.19
IUPAC Name(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate
SMILESCCCC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)CC1
InChIInChI=1S/C19H26O3/c1-3-4-15-7-12-18(13-8-15)22-19(20)14-9-16-5-10-17(21-2)11-6-16/h5-6,9-11,14-15,18H,3-4,7-8,12-13H2,1-2H3/b14-9+
InChIKeyRRVWESUXPGQASF-NTEUORMPSA-N
XLogP4.61
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.41
LogP ≤ 54.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The IUPAC name of (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate (CID 6048720) is (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate.
What is the SMILES notation for (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The canonical SMILES for (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate is CCCC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)CC1.
What is the InChIKey of (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The InChIKey is RRVWESUXPGQASF-NTEUORMPSA-N. The full InChI is InChI=1S/C19H26O3/c1-3-4-15-7-12-18(13-8-15)22-19(20)14-9-16-5-10-17(21-2)11-6-16/h5-6,9-11,14-15,18H,3-4,7-8,12-13H2,1-2H3/b14-9+.
What are the key properties of (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
(4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate has a molecular weight of 302.41 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylcyclohexyl) (E)-3-(4-methoxyphenyl)prop-2-enoate is sourced from PubChem (CID 6048720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).