C47H68N2O8 — CID 157144329
[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-butoxyphenyl)prop-2-enoate;[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 157144329) has the molecular formula C47H68N2O8 and a molecular weight of 789.07 g/mol. Its IUPAC name is [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-butoxyphenyl)prop-2-enoate;[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-butoxyphenyl)prop-2-enoate;[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 157144329 |
| Molecular Formula | C47H68N2O8 |
| Molecular Weight | 789.07 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-butoxyphenyl)prop-2-enoate;[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCC(C)(C)C(=O)NC1CCC(OC(=O)/C=C/c2ccc(OC)cc2)CC1.CCCCOc1ccc(/C=C/C(=O)OC2CCC(NC(=O)C(C)(C)CC)CC2)cc1 |
| InChI | InChI=1S/C25H37NO4.C22H31NO4/c1-5-7-18-29-21-13-8-19(9-14-21)10-17-23(27)30-22-15-11-20(12-16-22)26-24(28)25(3,4)6-2;1-5-22(2,3)21(25)23-17-9-13-19(14-10-17)27-20(24)15-8-16-6-11-18(26-4)12-7-16/h8-10,13-14,17,20,22H,5-7,11-12,15-16,18H2,1-4H3,(H,26,28);6-8,11-12,15,17,19H,5,9-10,13-14H2,1-4H3,(H,23,25)/b17-10+;15-8+ |
| InChIKey | AKNREUSXWVEZAR-AFVJITQFSA-N |
| XLogP | 9.40 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.07 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|