C28H43NO4 — CID 168837448
[4-[[(E)-3-(4-octoxyphenyl)prop-2-enoyl]amino]cyclohexyl] 2-methylbutanoate (PubChem CID 168837448) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is [4-[[(E)-3-(4-octoxyphenyl)prop-2-enoyl]amino]cyclohexyl] 2-methylbutanoate.
| Compound Name | [4-[[(E)-3-(4-octoxyphenyl)prop-2-enoyl]amino]cyclohexyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 168837448 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | [4-[[(E)-3-(4-octoxyphenyl)prop-2-enoyl]amino]cyclohexyl] 2-methylbutanoate |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)NC2CCC(OC(=O)C(C)CC)CC2)cc1 |
| InChI | InChI=1S/C28H43NO4/c1-4-6-7-8-9-10-21-32-25-16-11-23(12-17-25)13-20-27(30)29-24-14-18-26(19-15-24)33-28(31)22(3)5-2/h11-13,16-17,20,22,24,26H,4-10,14-15,18-19,21H2,1-3H3,(H,29,30)/b20-13+ |
| InChIKey | DLPSXZAAKHOSME-DEDYPNTBSA-N |
| XLogP | 6.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|