C28H44O5 — CID 162483593
[2,2-dimethyl-3-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxypropyl] 2-methylbutanoate (PubChem CID 162483593) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxypropyl] 2-methylbutanoate.
| Compound Name | [2,2-dimethyl-3-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxypropyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 162483593 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [2,2-dimethyl-3-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxypropyl] 2-methylbutanoate |
| SMILES | CCCCCCCCCOc1ccc(/C=C/C(=O)OCC(C)(C)COC(=O)C(C)CC)cc1 |
| InChI | InChI=1S/C28H44O5/c1-6-8-9-10-11-12-13-20-31-25-17-14-24(15-18-25)16-19-26(29)32-21-28(4,5)22-33-27(30)23(3)7-2/h14-19,23H,6-13,20-22H2,1-5H3/b19-16+ |
| InChIKey | PXJLDGHGBOQRTR-KNTRCKAVSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|