C34H44F9NO6 — CID 168780154
[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)cyclopentyl]oxyethoxy]phenyl]prop-2-enoate (PubChem CID 168780154) has the molecular formula C34H44F9NO6 and a molecular weight of 733.71 g/mol. Its IUPAC name is [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)cyclopentyl]oxyethoxy]phenyl]prop-2-enoate.
| Compound Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)cyclopentyl]oxyethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168780154 |
| Molecular Formula | C34H44F9NO6 |
| Molecular Weight | 733.71 g/mol |
| Exact Mass | 733.30 |
| IUPAC Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)cyclopentyl]oxyethoxy]phenyl]prop-2-enoate |
| SMILES | CCC(C)(C)C(=O)NC1CCC(OC(=O)/C=C/c2ccc(OCCOC3(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C34H44F9NO6/c1-4-29(2,3)28(46)44-24-10-14-26(15-11-24)50-27(45)16-9-23-7-12-25(13-8-23)47-21-22-49-30(17-5-6-18-30)48-20-19-31(35,36)32(37,38)33(39,40)34(41,42)43/h7-9,12-13,16,24,26H,4-6,10-11,14-15,17-22H2,1-3H3,(H,44,46)/b16-9+ |
| InChIKey | VZUOHVBAAWPSKK-CXUHLZMHSA-N |
| XLogP | 8.65 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.71 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|