C39H47F18NO7 — CID 168780170
[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[3-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]-4-methoxyphenyl]prop-2-enoate (PubChem CID 168780170) has the molecular formula C39H47F18NO7 and a molecular weight of 983.77 g/mol. Its IUPAC name is [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[3-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]-4-methoxyphenyl]prop-2-enoate.
| Compound Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[3-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168780170 |
| Molecular Formula | C39H47F18NO7 |
| Molecular Weight | 983.77 g/mol |
| Exact Mass | 983.31 |
| IUPAC Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[3-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]-4-methoxyphenyl]prop-2-enoate |
| SMILES | CCC(C)(C)C(=O)NC1CCC(OC(=O)/C=C/c2ccc(OC)c(OCCCC(C)(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C39H47F18NO7/c1-6-30(2,3)29(60)58-24-10-12-25(13-11-24)65-28(59)15-9-23-8-14-26(61-5)27(22-23)62-19-7-16-31(4,63-20-17-32(40,41)34(44,45)36(48,49)38(52,53)54)64-21-18-33(42,43)35(46,47)37(50,51)39(55,56)57/h8-9,14-15,22,24-25H,6-7,10-13,16-21H2,1-5H3,(H,58,60)/b15-9+ |
| InChIKey | BIVVOVTYBMNUAB-OQLLNIDSSA-N |
| XLogP | 11.74 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.77 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|