C16H11F13O3 — CID 23103673
3-methoxy-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzaldehyde (PubChem CID 23103673) has the molecular formula C16H11F13O3 and a molecular weight of 498.24 g/mol. Its IUPAC name is 3-methoxy-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzaldehyde.
| Compound Name | 3-methoxy-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzaldehyde |
|---|---|
| PubChem CID | 23103673 |
| Molecular Formula | C16H11F13O3 |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 3-methoxy-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H11F13O3/c1-31-10-6-8(7-30)2-3-9(10)32-5-4-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | ADKKCICYIUIGKA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|