C19H22O4 — CID 2284376
4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxybenzaldehyde (PubChem CID 2284376) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 2284376 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H22O4/c1-14-9-15(2)11-17(10-14)22-7-4-8-23-18-6-5-16(13-20)12-19(18)21-3/h5-6,9-13H,4,7-8H2,1-3H3 |
| InChIKey | WWVKECDFFLRQGT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|