C18H23NO3 — CID 82097195
4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxyaniline (PubChem CID 82097195) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxyaniline.
| Compound Name | 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxyaniline |
|---|---|
| PubChem CID | 82097195 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-[3-(3,5-dimethylphenoxy)propoxy]-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1OCCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H23NO3/c1-13-9-14(2)11-16(10-13)21-7-4-8-22-17-6-5-15(19)12-18(17)20-3/h5-6,9-12H,4,7-8,19H2,1-3H3 |
| InChIKey | ZFLRPGKXUQQCPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|