C16H19NO2 — CID 43247193
3-[(3,5-dimethylphenoxy)methyl]-4-methoxyaniline (PubChem CID 43247193) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenoxy)methyl]-4-methoxyaniline.
| Compound Name | 3-[(3,5-dimethylphenoxy)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 43247193 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[(3,5-dimethylphenoxy)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H19NO2/c1-11-6-12(2)8-15(7-11)19-10-13-9-14(17)4-5-16(13)18-3/h4-9H,10,17H2,1-3H3 |
| InChIKey | XBRVETPYOKNQDX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|