C38H45F18NO6 — CID 168780173
[4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]phenyl]prop-2-enoate (PubChem CID 168780173) has the molecular formula C38H45F18NO6 and a molecular weight of 953.74 g/mol. Its IUPAC name is [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]phenyl]prop-2-enoate.
| Compound Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168780173 |
| Molecular Formula | C38H45F18NO6 |
| Molecular Weight | 953.74 g/mol |
| Exact Mass | 953.30 |
| IUPAC Name | [4-(2,2-dimethylbutanoylamino)cyclohexyl] (E)-3-[4-[4,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pentoxy]phenyl]prop-2-enoate |
| SMILES | CCC(C)(C)C(=O)NC1CCC(OC(=O)/C=C/c2ccc(OCCCC(C)(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C38H45F18NO6/c1-5-29(2,3)28(59)57-24-10-14-26(15-11-24)63-27(58)16-9-23-7-12-25(13-8-23)60-20-6-17-30(4,61-21-18-31(39,40)33(43,44)35(47,48)37(51,52)53)62-22-19-32(41,42)34(45,46)36(49,50)38(54,55)56/h7-9,12-13,16,24,26H,5-6,10-11,14-15,17-22H2,1-4H3,(H,57,59)/b16-9+ |
| InChIKey | QKFYKUOUJJVSPS-CXUHLZMHSA-N |
| XLogP | 11.73 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.74 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|