C28H43NO4 — CID 155627211
[1-(2,2-dimethylbutanoyl)piperidin-4-yl] (E)-3-(4-octoxyphenyl)prop-2-enoate (PubChem CID 155627211) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is [1-(2,2-dimethylbutanoyl)piperidin-4-yl] (E)-3-(4-octoxyphenyl)prop-2-enoate.
| Compound Name | [1-(2,2-dimethylbutanoyl)piperidin-4-yl] (E)-3-(4-octoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 155627211 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | [1-(2,2-dimethylbutanoyl)piperidin-4-yl] (E)-3-(4-octoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)OC2CCN(C(=O)C(C)(C)CC)CC2)cc1 |
| InChI | InChI=1S/C28H43NO4/c1-5-7-8-9-10-11-22-32-24-15-12-23(13-16-24)14-17-26(30)33-25-18-20-29(21-19-25)27(31)28(3,4)6-2/h12-17,25H,5-11,18-22H2,1-4H3/b17-14+ |
| InChIKey | OJEGZKMJVPYWAD-SAPNQHFASA-N |
| XLogP | 6.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|