C25H26O6 — CID 89402377
[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 89402377) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 89402377 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxycyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC2CCC(OC(=O)/C=C/c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H26O6/c1-29-21-10-4-19(5-11-21)7-17-25(28)31-23-14-12-22(13-15-23)30-24(27)16-6-18-2-8-20(26)9-3-18/h2-11,16-17,22-23,26H,12-15H2,1H3/b16-6+,17-7+ |
| InChIKey | QIQYUMJPUIMOEX-KGMKFKQSSA-N |
| XLogP | 4.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|