C24H34O5 — CID 153307201
[4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2,2-dimethylbutanoate (PubChem CID 153307201) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2,2-dimethylbutanoate.
| Compound Name | [4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 153307201 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [4-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxymethyl]cyclohexyl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC(COC(=O)/C=C/c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H34O5/c1-5-24(2,3)23(26)29-17-20-8-6-19(7-9-20)16-28-22(25)15-12-18-10-13-21(27-4)14-11-18/h10-15,19-20H,5-9,16-17H2,1-4H3/b15-12+ |
| InChIKey | AMAXVIIQOFATDH-NTCAYCPXSA-N |
| XLogP | 5.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|