C20H26O3 — CID 59583279
(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 59583279) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 59583279 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC2CC3CC2C(C)C3C)cc1 |
| InChI | InChI=1S/C20H26O3/c1-13-14(2)19-11-16(13)10-17(19)12-23-20(21)9-6-15-4-7-18(22-3)8-5-15/h4-9,13-14,16-17,19H,10-12H2,1-3H3/b9-6+ |
| InChIKey | IOZSRFNUFMGSBT-RMKNXTFCSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|