C22H27FO4 — CID 118457500
2-[2-[(1S)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]acetyl]oxyethyl (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 118457500) has the molecular formula C22H27FO4 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-[2-[(1S)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]acetyl]oxyethyl (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | 2-[2-[(1S)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]acetyl]oxyethyl (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 118457500 |
| Molecular Formula | C22H27FO4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[2-[(1S)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]acetyl]oxyethyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CC1C2CC(CC(=O)OCCOC(=O)/C=C/c3ccc(F)cc3)[C@H](C2)C1C |
| InChI | InChI=1S/C22H27FO4/c1-14-15(2)20-12-17(14)11-18(20)13-22(25)27-10-9-26-21(24)8-5-16-3-6-19(23)7-4-16/h3-8,14-15,17-18,20H,9-13H2,1-2H3/b8-5+/t14?,15?,17?,18?,20-/m1/s1 |
| InChIKey | VLHBRZVGJBFMOX-DPYAGKCBSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|