C15H14BrFO4 — CID 70289071
2-[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]oxyethyl 2-methylprop-2-enoate (PubChem CID 70289071) has the molecular formula C15H14BrFO4 and a molecular weight of 357.18 g/mol. Its IUPAC name is 2-[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70289071 |
| Molecular Formula | C15H14BrFO4 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-[(E)-3-(3-bromo-4-fluorophenyl)prop-2-enoyl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)/C=C/c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H14BrFO4/c1-10(2)15(19)21-8-7-20-14(18)6-4-11-3-5-13(17)12(16)9-11/h3-6,9H,1,7-8H2,2H3/b6-4+ |
| InChIKey | IWYYINDTFJSBIJ-GQCTYLIASA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|