C15H12FN3O3 — CID 2468066
[2-oxo-2-(pyrimidin-2-ylamino)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 2468066) has the molecular formula C15H12FN3O3 and a molecular weight of 301.28 g/mol. Its IUPAC name is [2-oxo-2-(pyrimidin-2-ylamino)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(pyrimidin-2-ylamino)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2468066 |
| Molecular Formula | C15H12FN3O3 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [2-oxo-2-(pyrimidin-2-ylamino)ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)cc1)Nc1ncccn1 |
| InChI | InChI=1S/C15H12FN3O3/c16-12-5-2-11(3-6-12)4-7-14(21)22-10-13(20)19-15-17-8-1-9-18-15/h1-9H,10H2,(H,17,18,19,20)/b7-4+ |
| InChIKey | GLSMJBVDJXZFCC-QPJJXVBHSA-N |
| XLogP | 1.81 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|