C23H18F2N2O4 — CID 55737572
[2-(2,4-difluoroanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55737572) has the molecular formula C23H18F2N2O4 and a molecular weight of 424.40 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55737572 |
| Molecular Formula | C23H18F2N2O4 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(OCc2ccccn2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H18F2N2O4/c24-17-7-10-21(20(25)13-17)27-22(28)15-31-23(29)11-6-16-4-8-19(9-5-16)30-14-18-3-1-2-12-26-18/h1-13H,14-15H2,(H,27,28) |
| InChIKey | FHYYEZJOQFHSOK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|