C22H24N2O4 — CID 55737778
[2-(cyclopentylamino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55737778) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55737778 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(OCc2ccccn2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C22H24N2O4/c25-21(24-18-5-1-2-6-18)16-28-22(26)13-10-17-8-11-20(12-9-17)27-15-19-7-3-4-14-23-19/h3-4,7-14,18H,1-2,5-6,15-16H2,(H,24,25) |
| InChIKey | MFHIUODUHUSOIW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|