C22H29NO4 — CID 71954177
[2-(cyclooctylamino)-2-oxoethyl] 3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 71954177) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 3-(4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 3-(4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71954177 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(C=CC(=O)OCC(=O)NC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-2-16-26-20-13-10-18(11-14-20)12-15-22(25)27-17-21(24)23-19-8-6-4-3-5-7-9-19/h2,10-15,19H,1,3-9,16-17H2,(H,23,24) |
| InChIKey | GNYYMSPMLCCHOW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|