C17H20BrNO3 — CID 4802335
[2-(cyclohexylamino)-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate (PubChem CID 4802335) has the molecular formula C17H20BrNO3 and a molecular weight of 366.25 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4802335 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cccc(Br)c1)NC1CCCCC1 |
| InChI | InChI=1S/C17H20BrNO3/c18-14-6-4-5-13(11-14)9-10-17(21)22-12-16(20)19-15-7-2-1-3-8-15/h4-6,9-11,15H,1-3,7-8,12H2,(H,19,20) |
| InChIKey | HETLOMOZHDBXLR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|