C30H26N2O4 — CID 55737806
[2-(2-benzylanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55737806) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55737806 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(OCc2ccccn2)cc1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C30H26N2O4/c33-29(32-28-12-5-4-10-25(28)20-24-8-2-1-3-9-24)22-36-30(34)18-15-23-13-16-27(17-14-23)35-21-26-11-6-7-19-31-26/h1-19H,20-22H2,(H,32,33) |
| InChIKey | HHQRPHHQIQZMFW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|