C23H26O5 — CID 153307234
[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyphenyl]methyl 2,2-dimethylbutanoate (PubChem CID 153307234) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyphenyl]methyl 2,2-dimethylbutanoate.
| Compound Name | [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyphenyl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 153307234 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyphenyl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCc1ccc(OC(=O)/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H26O5/c1-5-23(2,3)22(25)27-16-18-8-13-20(14-9-18)28-21(24)15-10-17-6-11-19(26-4)12-7-17/h6-15H,5,16H2,1-4H3/b15-10+ |
| InChIKey | AVYRNLMNTJZYLO-XNTDXEJSSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|