C37H40O10 — CID 90337436
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-[4-[4-[3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]phenyl]phenyl] butanedioate (PubChem CID 90337436) has the molecular formula C37H40O10 and a molecular weight of 644.72 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-[4-[4-[3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]phenyl]phenyl] butanedioate.
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-[4-[4-[3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]phenyl]phenyl] butanedioate |
|---|---|
| PubChem CID | 90337436 |
| Molecular Formula | C37H40O10 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-[4-[4-[3-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]-3-oxopropyl]phenyl]phenyl] butanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)Oc1ccc(-c2ccc(CCC(=O)Oc3ccc(/C=C/C(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H40O10/c1-5-37(2,3)36(42)45-25-24-44-33(39)22-23-35(41)47-31-18-14-29(15-19-31)28-12-6-26(7-13-28)11-21-34(40)46-30-16-8-27(9-17-30)10-20-32(38)43-4/h6-10,12-20H,5,11,21-25H2,1-4H3/b20-10+ |
| InChIKey | NMKVCKJCCRLHGL-KEBDBYFISA-N |
| XLogP | 6.29 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|