C39H38O11 — CID 163577859
1-O-(4-oxohex-5-enyl) 4-O-[3-oxo-3-[4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethyl)phenoxy]prop-1-enyl]phenyl]phenoxy]propyl] butanedioate (PubChem CID 163577859) has the molecular formula C39H38O11 and a molecular weight of 682.72 g/mol. Its IUPAC name is 1-O-(4-oxohex-5-enyl) 4-O-[3-oxo-3-[4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethyl)phenoxy]prop-1-enyl]phenyl]phenoxy]propyl] butanedioate.
| Compound Name | 1-O-(4-oxohex-5-enyl) 4-O-[3-oxo-3-[4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethyl)phenoxy]prop-1-enyl]phenyl]phenoxy]propyl] butanedioate |
|---|---|
| PubChem CID | 163577859 |
| Molecular Formula | C39H38O11 |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | 1-O-(4-oxohex-5-enyl) 4-O-[3-oxo-3-[4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethyl)phenoxy]prop-1-enyl]phenyl]phenoxy]propyl] butanedioate |
| SMILES | C=CC(=O)CCCOC(=O)CCC(=O)OCCC(=O)Oc1ccc(-c2ccc(/C=C/C(=O)Oc3ccc(CCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H38O11/c1-3-32(40)6-5-25-46-36(42)21-22-37(43)48-27-24-39(45)50-34-18-14-31(15-19-34)30-12-7-28(8-13-30)11-20-38(44)49-33-16-9-29(10-17-33)23-26-47-35(41)4-2/h3-4,7-20H,1-2,5-6,21-27H2/b20-11+ |
| InChIKey | GFBFESBXYZNILA-RGVLZGJSSA-N |
| XLogP | 5.94 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|