C36H42O8 — CID 76574843
[4-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]phenyl] 4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]benzoate (PubChem CID 76574843) has the molecular formula C36H42O8 and a molecular weight of 602.72 g/mol. Its IUPAC name is [4-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]phenyl] 4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]benzoate.
| Compound Name | [4-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]phenyl] 4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 76574843 |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [4-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]phenyl] 4-[2-[2-(2,2-dimethylbutanoyloxy)ethoxy]ethoxy]benzoate |
| SMILES | CCCCOC(=O)C=Cc1ccc(-c2ccc(OC(=O)c3ccc(OCCOCCOC(=O)C(C)(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H42O8/c1-5-7-22-42-33(37)21-10-27-8-11-28(12-9-27)29-13-19-32(20-14-29)44-34(38)30-15-17-31(18-16-30)41-25-23-40-24-26-43-35(39)36(3,4)6-2/h8-21H,5-7,22-26H2,1-4H3 |
| InChIKey | HGMBJUDQJYHGRO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|