C35H55NO8Si — CID 70023865
5-(3-triethoxysilylpropylcarbamoyloxy)pentyl (E)-3-(6-heptoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 70023865) has the molecular formula C35H55NO8Si and a molecular weight of 645.91 g/mol. Its IUPAC name is 5-(3-triethoxysilylpropylcarbamoyloxy)pentyl (E)-3-(6-heptoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | 5-(3-triethoxysilylpropylcarbamoyloxy)pentyl (E)-3-(6-heptoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 70023865 |
| Molecular Formula | C35H55NO8Si |
| Molecular Weight | 645.91 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 5-(3-triethoxysilylpropylcarbamoyloxy)pentyl (E)-3-(6-heptoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | CCCCCCCOc1ccc2cc(/C=C/C(=O)OCCCCCOC(=O)NCCC[Si](OCC)(OCC)OCC)ccc2c1 |
| InChI | InChI=1S/C35H55NO8Si/c1-5-9-10-11-13-24-39-33-21-20-31-28-30(17-19-32(31)29-33)18-22-34(37)40-25-14-12-15-26-41-35(38)36-23-16-27-45(42-6-2,43-7-3)44-8-4/h17-22,28-29H,5-16,23-27H2,1-4H3,(H,36,38)/b22-18+ |
| InChIKey | HGFKIMVYXAOIIR-RELWKKBWSA-N |
| XLogP | 8.08 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.91 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|