C37H59NO8Si — CID 70022186
6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(6-octoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 70022186) has the molecular formula C37H59NO8Si and a molecular weight of 673.96 g/mol. Its IUPAC name is 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(6-octoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(6-octoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 70022186 |
| Molecular Formula | C37H59NO8Si |
| Molecular Weight | 673.96 g/mol |
| Exact Mass | 673.40 |
| IUPAC Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(6-octoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | CCCCCCCCOc1ccc2cc(/C=C/C(=O)OCCCCCCOC(=O)NCCC[Si](OCC)(OCC)OCC)ccc2c1 |
| InChI | InChI=1S/C37H59NO8Si/c1-5-9-10-11-12-15-26-41-35-23-22-33-30-32(19-21-34(33)31-35)20-24-36(39)42-27-16-13-14-17-28-43-37(40)38-25-18-29-47(44-6-2,45-7-3)46-8-4/h19-24,30-31H,5-18,25-29H2,1-4H3,(H,38,40)/b24-20+ |
| InChIKey | ODSXUPILXQZEOR-HIXSDJFHSA-N |
| XLogP | 8.86 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.96 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|