C27H37NO7Si — CID 101027056
2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 101027056) has the molecular formula C27H37NO7Si and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 101027056 |
| Molecular Formula | C27H37NO7Si |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCOc1ccc(/C=C/C(=O)c2ccccc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C27H37NO7Si/c1-4-33-36(34-5-2,35-6-3)22-10-19-28-27(30)32-21-20-31-25-16-13-23(14-17-25)15-18-26(29)24-11-8-7-9-12-24/h7-9,11-18H,4-6,10,19-22H2,1-3H3,(H,28,30)/b18-15+ |
| InChIKey | YTMVUYLWDAWVJC-OBGWFSINSA-N |
| XLogP | 5.13 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|