C26H37NO8Si — CID 70128744
(E)-3-[4-[3-(3-triethoxysilylpropylcarbamoyloxy)propoxy]naphthalen-1-yl]prop-2-enoic acid (PubChem CID 70128744) has the molecular formula C26H37NO8Si and a molecular weight of 519.67 g/mol. Its IUPAC name is (E)-3-[4-[3-(3-triethoxysilylpropylcarbamoyloxy)propoxy]naphthalen-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(3-triethoxysilylpropylcarbamoyloxy)propoxy]naphthalen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70128744 |
| Molecular Formula | C26H37NO8Si |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (E)-3-[4-[3-(3-triethoxysilylpropylcarbamoyloxy)propoxy]naphthalen-1-yl]prop-2-enoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCCCOc1ccc(/C=C/C(=O)O)c2ccccc12)(OCC)OCC |
| InChI | InChI=1S/C26H37NO8Si/c1-4-33-36(34-5-2,35-6-3)20-9-17-27-26(30)32-19-10-18-31-24-15-13-21(14-16-25(28)29)22-11-7-8-12-23(22)24/h7-8,11-16H,4-6,9-10,17-20H2,1-3H3,(H,27,30)(H,28,29)/b16-14+ |
| InChIKey | YWBVGJUONBXARI-JQIJEIRASA-N |
| XLogP | 4.87 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|