C29H43NO8Si — CID 139766244
methyl (E)-3-[4-[6-(2-triethoxysilylethylcarbamoyloxy)hexoxy]naphthalen-1-yl]prop-2-enoate (PubChem CID 139766244) has the molecular formula C29H43NO8Si and a molecular weight of 561.75 g/mol. Its IUPAC name is methyl (E)-3-[4-[6-(2-triethoxysilylethylcarbamoyloxy)hexoxy]naphthalen-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[6-(2-triethoxysilylethylcarbamoyloxy)hexoxy]naphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139766244 |
| Molecular Formula | C29H43NO8Si |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | methyl (E)-3-[4-[6-(2-triethoxysilylethylcarbamoyloxy)hexoxy]naphthalen-1-yl]prop-2-enoate |
| SMILES | CCO[Si](CCNC(=O)OCCCCCCOc1ccc(/C=C/C(=O)OC)c2ccccc12)(OCC)OCC |
| InChI | InChI=1S/C29H43NO8Si/c1-5-36-39(37-6-2,38-7-3)23-20-30-29(32)35-22-13-9-8-12-21-34-27-18-16-24(17-19-28(31)33-4)25-14-10-11-15-26(25)27/h10-11,14-19H,5-9,12-13,20-23H2,1-4H3,(H,30,32)/b19-17+ |
| InChIKey | UGUUSSJDKOQSJF-HTXNQAPBSA-N |
| XLogP | 5.74 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|