methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate

C28H46O5 — CID 58785374

IUPACmethyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate
SMILESCCCCCCOc1ccc(/C=C/C(=O)OC)c(OCCCCCC)c1OCCCCCC
InChIInChI=1S/C28H46O5/c1-5-8-11-14-21-31-25-19-17-24(18-20-26(29)30-4)27(32-22-15-12-9-6-2)28(25)33-23-16-13-10-7-3/h17-20H,5-16,21-23H2,1-4H3/b20-18+
InChIKeyPHJMRELYFFVPFV-CZIZESTLSA-N
MW462.67 g/mol
LogP7.75
Rot. Bonds20

About methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate

methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate (PubChem CID 58785374) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate
PubChem CID58785374
Molecular FormulaC28H46O5
Molecular Weight462.67 g/mol
Exact Mass462.33
IUPAC Namemethyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate
SMILESCCCCCCOc1ccc(/C=C/C(=O)OC)c(OCCCCCC)c1OCCCCCC
InChIInChI=1S/C28H46O5/c1-5-8-11-14-21-31-25-19-17-24(18-20-26(29)30-4)27(32-22-15-12-9-6-2)28(25)33-23-16-13-10-7-3/h17-20H,5-16,21-23H2,1-4H3/b20-18+
InChIKeyPHJMRELYFFVPFV-CZIZESTLSA-N
XLogP7.75
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds20
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500462.67
LogP ≤ 57.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate (CID 58785374) is methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate is CCCCCCOc1ccc(/C=C/C(=O)OC)c(OCCCCCC)c1OCCCCCC.
What is the InChIKey of methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate?
The InChIKey is PHJMRELYFFVPFV-CZIZESTLSA-N. The full InChI is InChI=1S/C28H46O5/c1-5-8-11-14-21-31-25-19-17-24(18-20-26(29)30-4)27(32-22-15-12-9-6-2)28(25)33-23-16-13-10-7-3/h17-20H,5-16,21-23H2,1-4H3/b20-18+.
What are the key properties of methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate?
methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate has a molecular weight of 462.67 g/mol, XLogP of 7.75, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate is sourced from PubChem (CID 58785374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).