C28H46O5 — CID 58785374
methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate (PubChem CID 58785374) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58785374 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | methyl (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)OC)c(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C28H46O5/c1-5-8-11-14-21-31-25-19-17-24(18-20-26(29)30-4)27(32-22-15-12-9-6-2)28(25)33-23-16-13-10-7-3/h17-20H,5-16,21-23H2,1-4H3/b20-18+ |
| InChIKey | PHJMRELYFFVPFV-CZIZESTLSA-N |
| XLogP | 7.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|