C67H100O14 — CID 91178194
1-O-[4-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenoxy]butyl] 4-O-methyl 3-ethyl-2,2-dimethylbutanedioate (PubChem CID 91178194) has the molecular formula C67H100O14 and a molecular weight of 1129.52 g/mol. Its IUPAC name is 1-O-[4-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenoxy]butyl] 4-O-methyl 3-ethyl-2,2-dimethylbutanedioate.
| Compound Name | 1-O-[4-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenoxy]butyl] 4-O-methyl 3-ethyl-2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 91178194 |
| Molecular Formula | C67H100O14 |
| Molecular Weight | 1129.52 g/mol |
| Exact Mass | 1128.71 |
| IUPAC Name | 1-O-[4-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenoxy]butyl] 4-O-methyl 3-ethyl-2,2-dimethylbutanedioate |
| SMILES | CCCCCCOc1ccc(C=CC(=O)Oc2ccc(OC(=O)C=Cc3ccc(OCCCCOC(=O)C(C)(C)C(CC)C(=O)OC)c(OCCCCCC)c3OCCCCCC)cc2)c(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C67H100O14/c1-10-16-21-26-45-73-57-41-33-52(61(75-47-27-22-17-11-2)63(57)77-49-29-24-19-13-4)35-43-59(68)80-54-37-39-55(40-38-54)81-60(69)44-36-53-34-42-58(64(78-50-30-25-20-14-5)62(53)76-48-28-23-18-12-3)74-46-31-32-51-79-66(71)67(7,8)56(15-6)65(70)72-9/h33-44,56H,10-32,45-51H2,1-9H3 |
| InChIKey | LLAHAXTZHVIOAE-UHFFFAOYSA-N |
| XLogP | 16.65 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.52 |
| LogP ≤ 5 | 16.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|