3-(2,3-dihexoxyphenyl)prop-2-enoic acid

C21H32O4 — CID 151218954

IUPAC3-(2,3-dihexoxyphenyl)prop-2-enoic acid
SMILESCCCCCCOc1cccc(C=CC(=O)O)c1OCCCCCC
InChIInChI=1S/C21H32O4/c1-3-5-7-9-16-24-19-13-11-12-18(14-15-20(22)23)21(19)25-17-10-8-6-4-2/h11-15H,3-10,16-17H2,1-2H3,(H,22,23)
InChIKeyNLWBBQUIMMUNJU-UHFFFAOYSA-N
MW348.48 g/mol
LogP5.70
Rot. Bonds14

About 3-(2,3-dihexoxyphenyl)prop-2-enoic acid

3-(2,3-dihexoxyphenyl)prop-2-enoic acid (PubChem CID 151218954) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-(2,3-dihexoxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2,3-dihexoxyphenyl)prop-2-enoic acid
PubChem CID151218954
Molecular FormulaC21H32O4
Molecular Weight348.48 g/mol
Exact Mass348.23
IUPAC Name3-(2,3-dihexoxyphenyl)prop-2-enoic acid
SMILESCCCCCCOc1cccc(C=CC(=O)O)c1OCCCCCC
InChIInChI=1S/C21H32O4/c1-3-5-7-9-16-24-19-13-11-12-18(14-15-20(22)23)21(19)25-17-10-8-6-4-2/h11-15H,3-10,16-17H2,1-2H3,(H,22,23)
InChIKeyNLWBBQUIMMUNJU-UHFFFAOYSA-N
XLogP5.70
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500348.48
LogP ≤ 55.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2,3-dihexoxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihexoxyphenyl)prop-2-enoic acid?
The IUPAC name of 3-(2,3-dihexoxyphenyl)prop-2-enoic acid (CID 151218954) is 3-(2,3-dihexoxyphenyl)prop-2-enoic acid.
What is the SMILES notation for 3-(2,3-dihexoxyphenyl)prop-2-enoic acid?
The canonical SMILES for 3-(2,3-dihexoxyphenyl)prop-2-enoic acid is CCCCCCOc1cccc(C=CC(=O)O)c1OCCCCCC.
What is the InChIKey of 3-(2,3-dihexoxyphenyl)prop-2-enoic acid?
The InChIKey is NLWBBQUIMMUNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O4/c1-3-5-7-9-16-24-19-13-11-12-18(14-15-20(22)23)21(19)25-17-10-8-6-4-2/h11-15H,3-10,16-17H2,1-2H3,(H,22,23).
What are the key properties of 3-(2,3-dihexoxyphenyl)prop-2-enoic acid?
3-(2,3-dihexoxyphenyl)prop-2-enoic acid has a molecular weight of 348.48 g/mol, XLogP of 5.70, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihexoxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 151218954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).