C21H32O4 — CID 151218954
3-(2,3-dihexoxyphenyl)prop-2-enoic acid (PubChem CID 151218954) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-(2,3-dihexoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(2,3-dihexoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 151218954 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 3-(2,3-dihexoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCOc1cccc(C=CC(=O)O)c1OCCCCCC |
| InChI | InChI=1S/C21H32O4/c1-3-5-7-9-16-24-19-13-11-12-18(14-15-20(22)23)21(19)25-17-10-8-6-4-2/h11-15H,3-10,16-17H2,1-2H3,(H,22,23) |
| InChIKey | NLWBBQUIMMUNJU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|