C18H27NO4 — CID 39102258
(E)-3-[2-[2-(dipropylamino)ethoxy]-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 39102258) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-3-[2-[2-(dipropylamino)ethoxy]-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-(dipropylamino)ethoxy]-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39102258 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (E)-3-[2-[2-(dipropylamino)ethoxy]-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | CCCN(CCC)CCOc1c(/C=C/C(=O)O)cccc1OC |
| InChI | InChI=1S/C18H27NO4/c1-4-11-19(12-5-2)13-14-23-18-15(9-10-17(20)21)7-6-8-16(18)22-3/h6-10H,4-5,11-14H2,1-3H3,(H,20,21)/b10-9+ |
| InChIKey | ALYCHACTQLRHOD-MDZDMXLPSA-N |
| XLogP | 3.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|