C13H13F3O4S — CID 116616505
(E)-3-[3-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 116616505) has the molecular formula C13H13F3O4S and a molecular weight of 322.30 g/mol. Its IUPAC name is (E)-3-[3-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116616505 |
| Molecular Formula | C13H13F3O4S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (E)-3-[3-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | COc1cccc(/C=C/C(=O)O)c1OCCSC(F)(F)F |
| InChI | InChI=1S/C13H13F3O4S/c1-19-10-4-2-3-9(5-6-11(17)18)12(10)20-7-8-21-13(14,15)16/h2-6H,7-8H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | ISYKANFORLINKD-AATRIKPKSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|