C14H15F3O4 — CID 115514444
(E)-3-[3-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid (PubChem CID 115514444) has the molecular formula C14H15F3O4 and a molecular weight of 304.26 g/mol. Its IUPAC name is (E)-3-[3-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115514444 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (E)-3-[3-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cccc(/C=C/C(=O)O)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C14H15F3O4/c1-20-11-5-2-4-10(6-7-12(18)19)13(11)21-9-3-8-14(15,16)17/h2,4-7H,3,8-9H2,1H3,(H,18,19)/b7-6+ |
| InChIKey | CAJRBQOMMWMFCV-VOTSOKGWSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|